C12H14N4OS — CID 113355228
2-[[6-[(1R)-1-aminopropyl]-3-pyridinyl]sulfanyl]-1H-pyrimidin-6-one (PubChem CID 113355228) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-[[6-[(1R)-1-aminopropyl]-3-pyridinyl]sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[[6-[(1R)-1-aminopropyl]-3-pyridinyl]sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 113355228 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-[[6-[(1R)-1-aminopropyl]-3-pyridinyl]sulfanyl]-1H-pyrimidin-6-one |
| SMILES | CC[C@@H](N)c1ccc(Sc2nccc(=O)[nH]2)cn1 |
| InChI | InChI=1S/C12H14N4OS/c1-2-9(13)10-4-3-8(7-15-10)18-12-14-6-5-11(17)16-12/h3-7,9H,2,13H2,1H3,(H,14,16,17)/t9-/m1/s1 |
| InChIKey | MXSKJFAIDZEVON-SECBINFHSA-N |
| XLogP | 1.73 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |