C10H7N3OS — CID 106921446
2-amino-4-(1,3-oxazol-2-ylsulfanyl)benzonitrile (PubChem CID 106921446) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-amino-4-(1,3-oxazol-2-ylsulfanyl)benzonitrile.
| Compound Name | 2-amino-4-(1,3-oxazol-2-ylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 106921446 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-amino-4-(1,3-oxazol-2-ylsulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(Sc2ncco2)cc1N |
| InChI | InChI=1S/C10H7N3OS/c11-6-7-1-2-8(5-9(7)12)15-10-13-3-4-14-10/h1-5H,12H2 |
| InChIKey | DRFNRISCLRZMHY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|