C10H10N2O2S — CID 106921428
3-methoxy-5-(1,3-oxazol-2-ylsulfanyl)aniline (PubChem CID 106921428) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-methoxy-5-(1,3-oxazol-2-ylsulfanyl)aniline.
| Compound Name | 3-methoxy-5-(1,3-oxazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 106921428 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-methoxy-5-(1,3-oxazol-2-ylsulfanyl)aniline |
| SMILES | COc1cc(N)cc(Sc2ncco2)c1 |
| InChI | InChI=1S/C10H10N2O2S/c1-13-8-4-7(11)5-9(6-8)15-10-12-2-3-14-10/h2-6H,11H2,1H3 |
| InChIKey | OAQJCZOKGUIPJT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|