C7H6N4OS — CID 106928163
5-(1,3-oxazol-2-ylsulfanyl)pyrazin-2-amine (PubChem CID 106928163) has the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. Its IUPAC name is 5-(1,3-oxazol-2-ylsulfanyl)pyrazin-2-amine.
| Compound Name | 5-(1,3-oxazol-2-ylsulfanyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106928163 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 5-(1,3-oxazol-2-ylsulfanyl)pyrazin-2-amine |
| SMILES | Nc1cnc(Sc2ncco2)cn1 |
| InChI | InChI=1S/C7H6N4OS/c8-5-3-11-6(4-10-5)13-7-9-1-2-12-7/h1-4H,(H2,8,10) |
| InChIKey | RGHYLMGGCAEJLK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |