C10H11N3OS — CID 106923159
(1R)-1-[6-(1,3-oxazol-2-ylsulfanyl)-3-pyridinyl]ethanamine (PubChem CID 106923159) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is (1R)-1-[6-(1,3-oxazol-2-ylsulfanyl)-3-pyridinyl]ethanamine.
| Compound Name | (1R)-1-[6-(1,3-oxazol-2-ylsulfanyl)-3-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 106923159 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (1R)-1-[6-(1,3-oxazol-2-ylsulfanyl)-3-pyridinyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Sc2ncco2)nc1 |
| InChI | InChI=1S/C10H11N3OS/c1-7(11)8-2-3-9(13-6-8)15-10-12-4-5-14-10/h2-7H,11H2,1H3/t7-/m1/s1 |
| InChIKey | OREYWHOBOHIGAE-SSDOTTSWSA-N |
| XLogP | 2.24 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |