C10H12N4OS — CID 106928339
6-(1,3-oxazol-2-ylsulfanyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 106928339) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 6-(1,3-oxazol-2-ylsulfanyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-(1,3-oxazol-2-ylsulfanyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106928339 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 6-(1,3-oxazol-2-ylsulfanyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(N)cc(Sc2ncco2)n1 |
| InChI | InChI=1S/C10H12N4OS/c1-6(2)9-13-7(11)5-8(14-9)16-10-12-3-4-15-10/h3-6H,1-2H3,(H2,11,13,14) |
| InChIKey | ZWYCSJISTJHNBO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |