C11H10BrNO2S — CID 106926854
(1R)-1-[3-bromo-4-(1,3-oxazol-2-ylsulfanyl)phenyl]ethanol (PubChem CID 106926854) has the molecular formula C11H10BrNO2S and a molecular weight of 300.18 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(1,3-oxazol-2-ylsulfanyl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-(1,3-oxazol-2-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 106926854 |
| Molecular Formula | C11H10BrNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | (1R)-1-[3-bromo-4-(1,3-oxazol-2-ylsulfanyl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Sc2ncco2)c(Br)c1 |
| InChI | InChI=1S/C11H10BrNO2S/c1-7(14)8-2-3-10(9(12)6-8)16-11-13-4-5-15-11/h2-7,14H,1H3/t7-/m1/s1 |
| InChIKey | OXGXCJMZOYIJOH-SSDOTTSWSA-N |
| XLogP | 3.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |