C16H17BrOS — CID 63814157
1-[3-bromo-4-(2,5-dimethylphenyl)sulfanylphenyl]ethanol (PubChem CID 63814157) has the molecular formula C16H17BrOS and a molecular weight of 337.28 g/mol. Its IUPAC name is 1-[3-bromo-4-(2,5-dimethylphenyl)sulfanylphenyl]ethanol.
| Compound Name | 1-[3-bromo-4-(2,5-dimethylphenyl)sulfanylphenyl]ethanol |
|---|---|
| PubChem CID | 63814157 |
| Molecular Formula | C16H17BrOS |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-[3-bromo-4-(2,5-dimethylphenyl)sulfanylphenyl]ethanol |
| SMILES | Cc1ccc(C)c(Sc2ccc(C(C)O)cc2Br)c1 |
| InChI | InChI=1S/C16H17BrOS/c1-10-4-5-11(2)16(8-10)19-15-7-6-13(12(3)18)9-14(15)17/h4-9,12,18H,1-3H3 |
| InChIKey | KOMYAQXHVPBUAF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |