C15H12BrNS — CID 82799241
3-bromo-4-(2,5-dimethylphenyl)sulfanylbenzonitrile (PubChem CID 82799241) has the molecular formula C15H12BrNS and a molecular weight of 318.24 g/mol. Its IUPAC name is 3-bromo-4-(2,5-dimethylphenyl)sulfanylbenzonitrile.
| Compound Name | 3-bromo-4-(2,5-dimethylphenyl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 82799241 |
| Molecular Formula | C15H12BrNS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-bromo-4-(2,5-dimethylphenyl)sulfanylbenzonitrile |
| SMILES | Cc1ccc(C)c(Sc2ccc(C#N)cc2Br)c1 |
| InChI | InChI=1S/C15H12BrNS/c1-10-3-4-11(2)15(7-10)18-14-6-5-12(9-17)8-13(14)16/h3-8H,1-2H3 |
| InChIKey | GOLIXMBFDVGUGU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |