C14H9F2NS — CID 54934140
4-(2,4-difluorophenyl)sulfanyl-3-methylbenzonitrile (PubChem CID 54934140) has the molecular formula C14H9F2NS and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanyl-3-methylbenzonitrile.
| Compound Name | 4-(2,4-difluorophenyl)sulfanyl-3-methylbenzonitrile |
|---|---|
| PubChem CID | 54934140 |
| Molecular Formula | C14H9F2NS |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanyl-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9F2NS/c1-9-6-10(8-17)2-4-13(9)18-14-5-3-11(15)7-12(14)16/h2-7H,1H3 |
| InChIKey | GYXVOFWVYFUBLH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |