C13H6ClF2NS — CID 63538295
4-chloro-2-(2,4-difluorophenyl)sulfanylbenzonitrile (PubChem CID 63538295) has the molecular formula C13H6ClF2NS and a molecular weight of 281.71 g/mol. Its IUPAC name is 4-chloro-2-(2,4-difluorophenyl)sulfanylbenzonitrile.
| Compound Name | 4-chloro-2-(2,4-difluorophenyl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 63538295 |
| Molecular Formula | C13H6ClF2NS |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 4-chloro-2-(2,4-difluorophenyl)sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C13H6ClF2NS/c14-9-2-1-8(7-17)13(5-9)18-12-4-3-10(15)6-11(12)16/h1-6H |
| InChIKey | VOBXLGIMKYJWJW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |