C12H8ClF2NS — CID 43345451
5-chloro-2-(2,4-difluorophenyl)sulfanylaniline (PubChem CID 43345451) has the molecular formula C12H8ClF2NS and a molecular weight of 271.72 g/mol. Its IUPAC name is 5-chloro-2-(2,4-difluorophenyl)sulfanylaniline.
| Compound Name | 5-chloro-2-(2,4-difluorophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 43345451 |
| Molecular Formula | C12H8ClF2NS |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 5-chloro-2-(2,4-difluorophenyl)sulfanylaniline |
| SMILES | Nc1cc(Cl)ccc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C12H8ClF2NS/c13-7-1-3-12(10(16)5-7)17-11-4-2-8(14)6-9(11)15/h1-6H,16H2 |
| InChIKey | RPZARTAPRFLUJM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|