C13H11F2NO2S2 — CID 43448248
2-(2,4-difluorophenyl)sulfanyl-5-methylsulfonylaniline (PubChem CID 43448248) has the molecular formula C13H11F2NO2S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-5-methylsulfonylaniline.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-5-methylsulfonylaniline |
|---|---|
| PubChem CID | 43448248 |
| Molecular Formula | C13H11F2NO2S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-5-methylsulfonylaniline |
| SMILES | CS(=O)(=O)c1ccc(Sc2ccc(F)cc2F)c(N)c1 |
| InChI | InChI=1S/C13H11F2NO2S2/c1-20(17,18)9-3-5-13(11(16)7-9)19-12-4-2-8(14)6-10(12)15/h2-7H,16H2,1H3 |
| InChIKey | WYJGYKLQLBSFEB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|