C13H10F3NOS — CID 55217046
2-(2,4-difluorophenyl)sulfanyl-5-fluoro-4-methoxyaniline (PubChem CID 55217046) has the molecular formula C13H10F3NOS and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-5-fluoro-4-methoxyaniline.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-5-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 55217046 |
| Molecular Formula | C13H10F3NOS |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-5-fluoro-4-methoxyaniline |
| SMILES | COc1cc(Sc2ccc(F)cc2F)c(N)cc1F |
| InChI | InChI=1S/C13H10F3NOS/c1-18-11-6-13(10(17)5-8(11)15)19-12-3-2-7(14)4-9(12)16/h2-6H,17H2,1H3 |
| InChIKey | SZCHSBNGRZRVTC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|