C7H7F2NO — CID 45090681
2,5-difluoro-4-methoxyaniline (PubChem CID 45090681) has the molecular formula C7H7F2NO and a molecular weight of 159.13 g/mol. Its IUPAC name is 2,5-difluoro-4-methoxyaniline.
| Compound Name | 2,5-difluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 45090681 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.13 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 2,5-difluoro-4-methoxyaniline |
| SMILES | COc1cc(F)c(N)cc1F |
| InChI | InChI=1S/C7H7F2NO/c1-11-7-3-4(8)6(10)2-5(7)9/h2-3H,10H2,1H3 |
| InChIKey | XAQBYYZISMYWAO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|