C7H9FN2O — CID 107258755
2-fluoro-5-methoxybenzene-1,4-diamine (PubChem CID 107258755) has the molecular formula C7H9FN2O and a molecular weight of 156.16 g/mol. Its IUPAC name is 2-fluoro-5-methoxybenzene-1,4-diamine.
| Compound Name | 2-fluoro-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 107258755 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-fluoro-5-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(N)c(F)cc1N |
| InChI | InChI=1S/C7H9FN2O/c1-11-7-3-5(9)4(8)2-6(7)10/h2-3H,9-10H2,1H3 |
| InChIKey | FRMXTQFATAQLTH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|