C8H10BFO4 — CID 164893901
(5-fluoro-2,4-dimethoxyphenyl)boronic acid (PubChem CID 164893901) has the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. Its IUPAC name is (5-fluoro-2,4-dimethoxyphenyl)boronic acid.
| Compound Name | (5-fluoro-2,4-dimethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 164893901 |
| Molecular Formula | C8H10BFO4 |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (5-fluoro-2,4-dimethoxyphenyl)boronic acid |
| SMILES | COc1cc(OC)c(B(O)O)cc1F |
| InChI | InChI=1S/C8H10BFO4/c1-13-7-4-8(14-2)6(10)3-5(7)9(11)12/h3-4,11-12H,1-2H3 |
| InChIKey | ZNONBDHANICIQE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|