C10H15BO5 — CID 164893391
(4-ethoxy-2,5-dimethoxyphenyl)boronic acid (PubChem CID 164893391) has the molecular formula C10H15BO5 and a molecular weight of 226.04 g/mol. Its IUPAC name is (4-ethoxy-2,5-dimethoxyphenyl)boronic acid.
| Compound Name | (4-ethoxy-2,5-dimethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 164893391 |
| Molecular Formula | C10H15BO5 |
| Molecular Weight | 226.04 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (4-ethoxy-2,5-dimethoxyphenyl)boronic acid |
| SMILES | CCOc1cc(OC)c(B(O)O)cc1OC |
| InChI | InChI=1S/C10H15BO5/c1-4-16-10-6-8(14-2)7(11(12)13)5-9(10)15-3/h5-6,12-13H,4H2,1-3H3 |
| InChIKey | FTLAMUBSWWDOGP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.04 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|