C10H15BO3 — CID 44558120
(4-ethoxy-2,5-dimethylphenyl)boronic acid (PubChem CID 44558120) has the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. Its IUPAC name is (4-ethoxy-2,5-dimethylphenyl)boronic acid.
| Compound Name | (4-ethoxy-2,5-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 44558120 |
| Molecular Formula | C10H15BO3 |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (4-ethoxy-2,5-dimethylphenyl)boronic acid |
| SMILES | CCOc1cc(C)c(B(O)O)cc1C |
| InChI | InChI=1S/C10H15BO3/c1-4-14-10-6-7(2)9(11(12)13)5-8(10)3/h5-6,12-13H,4H2,1-3H3 |
| InChIKey | LCSUJJZAQIIJTR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|