C10H15BO4 — CID 45094210
(2,5-diethoxyphenyl)boronic acid (PubChem CID 45094210) has the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. Its IUPAC name is (2,5-diethoxyphenyl)boronic acid.
| Compound Name | (2,5-diethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 45094210 |
| Molecular Formula | C10H15BO4 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2,5-diethoxyphenyl)boronic acid |
| SMILES | CCOc1ccc(OCC)c(B(O)O)c1 |
| InChI | InChI=1S/C10H15BO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7,12-13H,3-4H2,1-2H3 |
| InChIKey | KKXIRRFIDNBKJL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|