(2,5-diethoxyphenyl)boronic acid

C10H15BO4 — CID 45094210

IUPAC(2,5-diethoxyphenyl)boronic acid
SMILESCCOc1ccc(OCC)c(B(O)O)c1
InChIInChI=1S/C10H15BO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7,12-13H,3-4H2,1-2H3
InChIKeyKKXIRRFIDNBKJL-UHFFFAOYSA-N
MW210.04 g/mol
LogP0.16
Rot. Bonds5

About (2,5-diethoxyphenyl)boronic acid

(2,5-diethoxyphenyl)boronic acid (PubChem CID 45094210) has the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. Its IUPAC name is (2,5-diethoxyphenyl)boronic acid.

Molecular Properties

Compound Name(2,5-diethoxyphenyl)boronic acid
PubChem CID45094210
Molecular FormulaC10H15BO4
Molecular Weight210.04 g/mol
Exact Mass210.11
IUPAC Name(2,5-diethoxyphenyl)boronic acid
SMILESCCOc1ccc(OCC)c(B(O)O)c1
InChIInChI=1S/C10H15BO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7,12-13H,3-4H2,1-2H3
InChIKeyKKXIRRFIDNBKJL-UHFFFAOYSA-N
XLogP0.16
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.04
LogP ≤ 50.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,5-diethoxyphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-diethoxyphenyl)boronic acid?
The IUPAC name of (2,5-diethoxyphenyl)boronic acid (CID 45094210) is (2,5-diethoxyphenyl)boronic acid.
What is the SMILES notation for (2,5-diethoxyphenyl)boronic acid?
The canonical SMILES for (2,5-diethoxyphenyl)boronic acid is CCOc1ccc(OCC)c(B(O)O)c1.
What is the InChIKey of (2,5-diethoxyphenyl)boronic acid?
The InChIKey is KKXIRRFIDNBKJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7,12-13H,3-4H2,1-2H3.
What are the key properties of (2,5-diethoxyphenyl)boronic acid?
(2,5-diethoxyphenyl)boronic acid has a molecular weight of 210.04 g/mol, XLogP of 0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-diethoxyphenyl)boronic acid is sourced from PubChem (CID 45094210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).