C15H12ClNS — CID 63538754
4-chloro-2-(2,4-dimethylphenyl)sulfanylbenzonitrile (PubChem CID 63538754) has the molecular formula C15H12ClNS and a molecular weight of 273.79 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dimethylphenyl)sulfanylbenzonitrile.
| Compound Name | 4-chloro-2-(2,4-dimethylphenyl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 63538754 |
| Molecular Formula | C15H12ClNS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-chloro-2-(2,4-dimethylphenyl)sulfanylbenzonitrile |
| SMILES | Cc1ccc(Sc2cc(Cl)ccc2C#N)c(C)c1 |
| InChI | InChI=1S/C15H12ClNS/c1-10-3-6-14(11(2)7-10)18-15-8-13(16)5-4-12(15)9-17/h3-8H,1-2H3 |
| InChIKey | BDHZIIMJUMGULZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |