C16H15NS — CID 107110779
2-(2,4-dimethylphenyl)sulfanyl-3-methylbenzonitrile (PubChem CID 107110779) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfanyl-3-methylbenzonitrile.
| Compound Name | 2-(2,4-dimethylphenyl)sulfanyl-3-methylbenzonitrile |
|---|---|
| PubChem CID | 107110779 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfanyl-3-methylbenzonitrile |
| SMILES | Cc1ccc(Sc2c(C)cccc2C#N)c(C)c1 |
| InChI | InChI=1S/C16H15NS/c1-11-7-8-15(13(3)9-11)18-16-12(2)5-4-6-14(16)10-17/h4-9H,1-3H3 |
| InChIKey | WGGDSNHBLNDFIC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |