C9H6F2N2OS — CID 106921442
3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)aniline (PubChem CID 106921442) has the molecular formula C9H6F2N2OS and a molecular weight of 228.22 g/mol. Its IUPAC name is 3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)aniline.
| Compound Name | 3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 106921442 |
| Molecular Formula | C9H6F2N2OS |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)aniline |
| SMILES | Nc1cc(F)c(Sc2ncco2)c(F)c1 |
| InChI | InChI=1S/C9H6F2N2OS/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9/h1-4H,12H2 |
| InChIKey | MDEDDTWVQPVZRH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|