C13H14F2N2OS — CID 106927064
1-[3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)phenyl]butan-2-amine (PubChem CID 106927064) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)phenyl]butan-2-amine.
| Compound Name | 1-[3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 106927064 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[3,5-difluoro-4-(1,3-oxazol-2-ylsulfanyl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(F)c(Sc2ncco2)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2OS/c1-2-9(16)5-8-6-10(14)12(11(15)7-8)19-13-17-3-4-18-13/h3-4,6-7,9H,2,5,16H2,1H3 |
| InChIKey | DNWNQBPRFFZNOB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |