C14H22F2N2 — CID 63787264
4-(2-aminobutyl)-2,6-difluoro-N-methyl-N-propan-2-ylaniline (PubChem CID 63787264) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-(2-aminobutyl)-2,6-difluoro-N-methyl-N-propan-2-ylaniline.
| Compound Name | 4-(2-aminobutyl)-2,6-difluoro-N-methyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 63787264 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-(2-aminobutyl)-2,6-difluoro-N-methyl-N-propan-2-ylaniline |
| SMILES | CCC(N)Cc1cc(F)c(N(C)C(C)C)c(F)c1 |
| InChI | InChI=1S/C14H22F2N2/c1-5-11(17)6-10-7-12(15)14(13(16)8-10)18(4)9(2)3/h7-9,11H,5-6,17H2,1-4H3 |
| InChIKey | UQOSNKPGOBBCTL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |