C17H28F2N2 — CID 79479930
4-(2-aminobutyl)-N-ethyl-2,6-difluoro-N-(2-methylbutyl)aniline (PubChem CID 79479930) has the molecular formula C17H28F2N2 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-(2-aminobutyl)-N-ethyl-2,6-difluoro-N-(2-methylbutyl)aniline.
| Compound Name | 4-(2-aminobutyl)-N-ethyl-2,6-difluoro-N-(2-methylbutyl)aniline |
|---|---|
| PubChem CID | 79479930 |
| Molecular Formula | C17H28F2N2 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-(2-aminobutyl)-N-ethyl-2,6-difluoro-N-(2-methylbutyl)aniline |
| SMILES | CCC(C)CN(CC)c1c(F)cc(CC(N)CC)cc1F |
| InChI | InChI=1S/C17H28F2N2/c1-5-12(4)11-21(7-3)17-15(18)9-13(10-16(17)19)8-14(20)6-2/h9-10,12,14H,5-8,11,20H2,1-4H3 |
| InChIKey | BKIDZNRPVFVNEJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |