C17H28F2N2 — CID 63787284
4-(2-aminopropyl)-N,N-dibutyl-2,6-difluoroaniline (PubChem CID 63787284) has the molecular formula C17H28F2N2 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-(2-aminopropyl)-N,N-dibutyl-2,6-difluoroaniline.
| Compound Name | 4-(2-aminopropyl)-N,N-dibutyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 63787284 |
| Molecular Formula | C17H28F2N2 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-(2-aminopropyl)-N,N-dibutyl-2,6-difluoroaniline |
| SMILES | CCCCN(CCCC)c1c(F)cc(CC(C)N)cc1F |
| InChI | InChI=1S/C17H28F2N2/c1-4-6-8-21(9-7-5-2)17-15(18)11-14(10-13(3)20)12-16(17)19/h11-13H,4-10,20H2,1-3H3 |
| InChIKey | LOSZCYXPAZSJKW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |