C11H16ClF2NO — CID 170894171
1-(4-ethoxy-3,5-difluorophenyl)propan-2-amine;hydrochloride (PubChem CID 170894171) has the molecular formula C11H16ClF2NO and a molecular weight of 251.70 g/mol. Its IUPAC name is 1-(4-ethoxy-3,5-difluorophenyl)propan-2-amine;hydrochloride.
| Compound Name | 1-(4-ethoxy-3,5-difluorophenyl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170894171 |
| Molecular Formula | C11H16ClF2NO |
| Molecular Weight | 251.70 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-(4-ethoxy-3,5-difluorophenyl)propan-2-amine;hydrochloride |
| SMILES | CCOc1c(F)cc(CC(C)N)cc1F.Cl |
| InChI | InChI=1S/C11H15F2NO.ClH/c1-3-15-11-9(12)5-8(4-7(2)14)6-10(11)13;/h5-7H,3-4,14H2,1-2H3;1H |
| InChIKey | IHKCQUJHULWKOU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |