C13H18F2N2O2 — CID 79887691
3-[4-(2-aminopropyl)-2,6-difluorophenoxy]-2-methylpropanamide (PubChem CID 79887691) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[4-(2-aminopropyl)-2,6-difluorophenoxy]-2-methylpropanamide.
| Compound Name | 3-[4-(2-aminopropyl)-2,6-difluorophenoxy]-2-methylpropanamide |
|---|---|
| PubChem CID | 79887691 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[4-(2-aminopropyl)-2,6-difluorophenoxy]-2-methylpropanamide |
| SMILES | CC(N)Cc1cc(F)c(OCC(C)C(N)=O)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O2/c1-7(13(17)18)6-19-12-10(14)4-9(3-8(2)16)5-11(12)15/h4-5,7-8H,3,6,16H2,1-2H3,(H2,17,18) |
| InChIKey | GBEPRQMNKXOKEE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |