C11H15F2NO — CID 79886822
[3,5-difluoro-4-(2-methylpropoxy)phenyl]methanamine (PubChem CID 79886822) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is [3,5-difluoro-4-(2-methylpropoxy)phenyl]methanamine.
| Compound Name | [3,5-difluoro-4-(2-methylpropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 79886822 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [3,5-difluoro-4-(2-methylpropoxy)phenyl]methanamine |
| SMILES | CC(C)COc1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C11H15F2NO/c1-7(2)6-15-11-9(12)3-8(5-14)4-10(11)13/h3-4,7H,5-6,14H2,1-2H3 |
| InChIKey | FSURHYQCSNJQIX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |