C13H19F2NO2 — CID 107702733
6-[4-(aminomethyl)-2,6-difluorophenoxy]hexan-1-ol (PubChem CID 107702733) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-2,6-difluorophenoxy]hexan-1-ol.
| Compound Name | 6-[4-(aminomethyl)-2,6-difluorophenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 107702733 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-[4-(aminomethyl)-2,6-difluorophenoxy]hexan-1-ol |
| SMILES | NCc1cc(F)c(OCCCCCCO)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO2/c14-11-7-10(9-16)8-12(15)13(11)18-6-4-2-1-3-5-17/h7-8,17H,1-6,9,16H2 |
| InChIKey | MOCRWPHNMBUJTC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|