C11H15F2NO3 — CID 79887012
2-[2-[4-(aminomethyl)-2,6-difluorophenoxy]ethoxy]ethanol (PubChem CID 79887012) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is 2-[2-[4-(aminomethyl)-2,6-difluorophenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-(aminomethyl)-2,6-difluorophenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 79887012 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-[2-[4-(aminomethyl)-2,6-difluorophenoxy]ethoxy]ethanol |
| SMILES | NCc1cc(F)c(OCCOCCO)c(F)c1 |
| InChI | InChI=1S/C11H15F2NO3/c12-9-5-8(7-14)6-10(13)11(9)17-4-3-16-2-1-15/h5-6,15H,1-4,7,14H2 |
| InChIKey | MGKWOPMHWSBJKN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|