C14H19ClF2O4 — CID 104564276
5-(chloromethyl)-1,3-difluoro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene (PubChem CID 104564276) has the molecular formula C14H19ClF2O4 and a molecular weight of 324.75 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-difluoro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene.
| Compound Name | 5-(chloromethyl)-1,3-difluoro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 104564276 |
| Molecular Formula | C14H19ClF2O4 |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-(chloromethyl)-1,3-difluoro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
| SMILES | COCCOCCOCCOc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C14H19ClF2O4/c1-18-2-3-19-4-5-20-6-7-21-14-12(16)8-11(10-15)9-13(14)17/h8-9H,2-7,10H2,1H3 |
| InChIKey | AGVXKNUKHHLEJL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|