C9H6ClF2NO — CID 79888430
2-[4-(chloromethyl)-2,6-difluorophenoxy]acetonitrile (PubChem CID 79888430) has the molecular formula C9H6ClF2NO and a molecular weight of 217.60 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2,6-difluorophenoxy]acetonitrile.
| Compound Name | 2-[4-(chloromethyl)-2,6-difluorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 79888430 |
| Molecular Formula | C9H6ClF2NO |
| Molecular Weight | 217.60 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 2-[4-(chloromethyl)-2,6-difluorophenoxy]acetonitrile |
| SMILES | N#CCOc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C9H6ClF2NO/c10-5-6-3-7(11)9(8(12)4-6)14-2-1-13/h3-4H,2,5H2 |
| InChIKey | OWRRAUOZFRSSTD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|