C14H9ClF4O — CID 114930615
5-(chloromethyl)-2-[(2,6-difluorophenyl)methoxy]-1,3-difluorobenzene (PubChem CID 114930615) has the molecular formula C14H9ClF4O and a molecular weight of 304.67 g/mol. Its IUPAC name is 5-(chloromethyl)-2-[(2,6-difluorophenyl)methoxy]-1,3-difluorobenzene.
| Compound Name | 5-(chloromethyl)-2-[(2,6-difluorophenyl)methoxy]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 114930615 |
| Molecular Formula | C14H9ClF4O |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 5-(chloromethyl)-2-[(2,6-difluorophenyl)methoxy]-1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1COc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C14H9ClF4O/c15-6-8-4-12(18)14(13(19)5-8)20-7-9-10(16)2-1-3-11(9)17/h1-5H,6-7H2 |
| InChIKey | SQYMOWXTXKWPFE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|