C12H9ClF2OS — CID 79887498
2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene (PubChem CID 79887498) has the molecular formula C12H9ClF2OS and a molecular weight of 274.72 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene.
| Compound Name | 2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene |
|---|---|
| PubChem CID | 79887498 |
| Molecular Formula | C12H9ClF2OS |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene |
| SMILES | Fc1cc(CCl)cc(F)c1OCc1cccs1 |
| InChI | InChI=1S/C12H9ClF2OS/c13-6-8-4-10(14)12(11(15)5-8)16-7-9-2-1-3-17-9/h1-5H,6-7H2 |
| InChIKey | QWGACIKNAGTVME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|