C12H8BrClF2OS — CID 79888273
4-bromo-2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene (PubChem CID 79888273) has the molecular formula C12H8BrClF2OS and a molecular weight of 353.62 g/mol. Its IUPAC name is 4-bromo-2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene.
| Compound Name | 4-bromo-2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene |
|---|---|
| PubChem CID | 79888273 |
| Molecular Formula | C12H8BrClF2OS |
| Molecular Weight | 353.62 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 4-bromo-2-[[4-(chloromethyl)-2,6-difluorophenoxy]methyl]thiophene |
| SMILES | Fc1cc(CCl)cc(F)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H8BrClF2OS/c13-8-3-9(18-6-8)5-17-12-10(15)1-7(4-14)2-11(12)16/h1-3,6H,4-5H2 |
| InChIKey | PNFCDLXNWJKPPB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|