C13H13BrOS — CID 63457355
4-bromo-2-[(2,6-dimethylphenoxy)methyl]thiophene (PubChem CID 63457355) has the molecular formula C13H13BrOS and a molecular weight of 297.22 g/mol. Its IUPAC name is 4-bromo-2-[(2,6-dimethylphenoxy)methyl]thiophene.
| Compound Name | 4-bromo-2-[(2,6-dimethylphenoxy)methyl]thiophene |
|---|---|
| PubChem CID | 63457355 |
| Molecular Formula | C13H13BrOS |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 4-bromo-2-[(2,6-dimethylphenoxy)methyl]thiophene |
| SMILES | Cc1cccc(C)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H13BrOS/c1-9-4-3-5-10(2)13(9)15-7-12-6-11(14)8-16-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | DRQJGNMTFYJKEW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |