4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid

C14H13BrO3S — CID 63530518

IUPAC4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCc1cc(Br)cs1
InChIInChI=1S/C14H13BrO3S/c1-8-3-10(14(16)17)4-9(2)13(8)18-6-12-5-11(15)7-19-12/h3-5,7H,6H2,1-2H3,(H,16,17)
InChIKeyQQHHJJSSWGOPIJ-UHFFFAOYSA-N
MW341.23 g/mol
LogP4.40
Rot. Bonds4

About 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid

4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid (PubChem CID 63530518) has the molecular formula C14H13BrO3S and a molecular weight of 341.23 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid.

Molecular Properties

Compound Name4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid
PubChem CID63530518
Molecular FormulaC14H13BrO3S
Molecular Weight341.23 g/mol
Exact Mass339.98
IUPAC Name4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCc1cc(Br)cs1
InChIInChI=1S/C14H13BrO3S/c1-8-3-10(14(16)17)4-9(2)13(8)18-6-12-5-11(15)7-19-12/h3-5,7H,6H2,1-2H3,(H,16,17)
InChIKeyQQHHJJSSWGOPIJ-UHFFFAOYSA-N
XLogP4.40
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.23
LogP ≤ 54.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid?
The IUPAC name of 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid (CID 63530518) is 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid.
What is the SMILES notation for 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid?
The canonical SMILES for 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid is Cc1cc(C(=O)O)cc(C)c1OCc1cc(Br)cs1.
What is the InChIKey of 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid?
The InChIKey is QQHHJJSSWGOPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO3S/c1-8-3-10(14(16)17)4-9(2)13(8)18-6-12-5-11(15)7-19-12/h3-5,7H,6H2,1-2H3,(H,16,17).
What are the key properties of 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid?
4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid has a molecular weight of 341.23 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzoic acid is sourced from PubChem (CID 63530518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).