C16H15IO3 — CID 65478013
4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzoic acid (PubChem CID 65478013) has the molecular formula C16H15IO3 and a molecular weight of 382.20 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 65478013 |
| Molecular Formula | C16H15IO3 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C16H15IO3/c1-10-7-13(16(18)19)8-11(2)15(10)20-9-12-3-5-14(17)6-4-12/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | IGWOAKPNIZRYEK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|