3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid

C14H9F3O3 — CID 79887700

IUPAC3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1cc(F)c(OCc2ccc(F)cc2)c(F)c1
InChIInChI=1S/C14H9F3O3/c15-10-3-1-8(2-4-10)7-20-13-11(16)5-9(14(18)19)6-12(13)17/h1-6H,7H2,(H,18,19)
InChIKeyNJMZOIOXGGAMAV-UHFFFAOYSA-N
MW282.22 g/mol
LogP3.38
Rot. Bonds4

About 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid

3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid (PubChem CID 79887700) has the molecular formula C14H9F3O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid.

Molecular Properties

Compound Name3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid
PubChem CID79887700
Molecular FormulaC14H9F3O3
Molecular Weight282.22 g/mol
Exact Mass282.05
IUPAC Name3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1cc(F)c(OCc2ccc(F)cc2)c(F)c1
InChIInChI=1S/C14H9F3O3/c15-10-3-1-8(2-4-10)7-20-13-11(16)5-9(14(18)19)6-12(13)17/h1-6H,7H2,(H,18,19)
InChIKeyNJMZOIOXGGAMAV-UHFFFAOYSA-N
XLogP3.38
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.22
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid?
The IUPAC name of 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid (CID 79887700) is 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid.
What is the SMILES notation for 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid?
The canonical SMILES for 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid is O=C(O)c1cc(F)c(OCc2ccc(F)cc2)c(F)c1.
What is the InChIKey of 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid?
The InChIKey is NJMZOIOXGGAMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3O3/c15-10-3-1-8(2-4-10)7-20-13-11(16)5-9(14(18)19)6-12(13)17/h1-6H,7H2,(H,18,19).
What are the key properties of 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid?
3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid has a molecular weight of 282.22 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-[(4-fluorophenyl)methoxy]benzoic acid is sourced from PubChem (CID 79887700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).