C13H7F5O — CID 112769771
1,2,4,5-tetrafluoro-3-[(4-fluorophenyl)methoxy]benzene (PubChem CID 112769771) has the molecular formula C13H7F5O and a molecular weight of 274.19 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[(4-fluorophenyl)methoxy]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[(4-fluorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 112769771 |
| Molecular Formula | C13H7F5O |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[(4-fluorophenyl)methoxy]benzene |
| SMILES | Fc1ccc(COc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C13H7F5O/c14-8-3-1-7(2-4-8)6-19-13-11(17)9(15)5-10(16)12(13)18/h1-5H,6H2 |
| InChIKey | IBUICDZGFXNFBT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|