C13H8F4O — CID 167523745
1,2,3,5-tetrafluoro-4-phenylmethoxybenzene (PubChem CID 167523745) has the molecular formula C13H8F4O and a molecular weight of 256.20 g/mol. Its IUPAC name is 1,2,3,5-tetrafluoro-4-phenylmethoxybenzene.
| Compound Name | 1,2,3,5-tetrafluoro-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 167523745 |
| Molecular Formula | C13H8F4O |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1,2,3,5-tetrafluoro-4-phenylmethoxybenzene |
| SMILES | Fc1cc(F)c(OCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C13H8F4O/c14-9-6-10(15)13(12(17)11(9)16)18-7-8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | RJFSWMDRFRUESJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|