C16H13F2IO3 — CID 137378527
ethyl 3,5-difluoro-2-iodo-4-phenylmethoxybenzoate (PubChem CID 137378527) has the molecular formula C16H13F2IO3 and a molecular weight of 418.18 g/mol. Its IUPAC name is ethyl 3,5-difluoro-2-iodo-4-phenylmethoxybenzoate.
| Compound Name | ethyl 3,5-difluoro-2-iodo-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 137378527 |
| Molecular Formula | C16H13F2IO3 |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | ethyl 3,5-difluoro-2-iodo-4-phenylmethoxybenzoate |
| SMILES | CCOC(=O)c1cc(F)c(OCc2ccccc2)c(F)c1I |
| InChI | InChI=1S/C16H13F2IO3/c1-2-21-16(20)11-8-12(17)15(13(18)14(11)19)22-9-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3 |
| InChIKey | NBQPMZRMOINWGL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|