C17H14F3NO3 — CID 21041174
ethyl 2,4,5-trifluoro-3-[(E)-phenylmethoxyiminomethyl]benzoate (PubChem CID 21041174) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is ethyl 2,4,5-trifluoro-3-[(E)-phenylmethoxyiminomethyl]benzoate.
| Compound Name | ethyl 2,4,5-trifluoro-3-[(E)-phenylmethoxyiminomethyl]benzoate |
|---|---|
| PubChem CID | 21041174 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | ethyl 2,4,5-trifluoro-3-[(E)-phenylmethoxyiminomethyl]benzoate |
| SMILES | CCOC(=O)c1cc(F)c(F)c(/C=N/OCc2ccccc2)c1F |
| InChI | InChI=1S/C17H14F3NO3/c1-2-23-17(22)12-8-14(18)16(20)13(15(12)19)9-21-24-10-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b21-9+ |
| InChIKey | IDCQRHBVSOPQSN-ZVBGSRNCSA-N |
| XLogP | 3.83 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|