C19H21NO4S — CID 25018944
ethyl (2S,3S,4E)-3-hydroxy-4-phenylmethoxyimino-2-phenylsulfanylbutanoate (PubChem CID 25018944) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl (2S,3S,4E)-3-hydroxy-4-phenylmethoxyimino-2-phenylsulfanylbutanoate.
| Compound Name | ethyl (2S,3S,4E)-3-hydroxy-4-phenylmethoxyimino-2-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 25018944 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl (2S,3S,4E)-3-hydroxy-4-phenylmethoxyimino-2-phenylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@@H](Sc1ccccc1)[C@@H](O)/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c1-2-23-19(22)18(25-16-11-7-4-8-12-16)17(21)13-20-24-14-15-9-5-3-6-10-15/h3-13,17-18,21H,2,14H2,1H3/b20-13+/t17-,18-/m0/s1 |
| InChIKey | CDCDLLWXYVGCAE-XYLSPAALSA-N |
| XLogP | 3.27 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|