C23H27NO4 — CID 177444014
ethyl (E)-4-hydroxy-4-phenyl-3-[(E)-phenylmethoxyiminomethyl]-2-propan-2-ylbut-2-enoate (PubChem CID 177444014) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl (E)-4-hydroxy-4-phenyl-3-[(E)-phenylmethoxyiminomethyl]-2-propan-2-ylbut-2-enoate.
| Compound Name | ethyl (E)-4-hydroxy-4-phenyl-3-[(E)-phenylmethoxyiminomethyl]-2-propan-2-ylbut-2-enoate |
|---|---|
| PubChem CID | 177444014 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | ethyl (E)-4-hydroxy-4-phenyl-3-[(E)-phenylmethoxyiminomethyl]-2-propan-2-ylbut-2-enoate |
| SMILES | CCOC(=O)/C(=C(\C=N\OCc1ccccc1)C(O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H27NO4/c1-4-27-23(26)21(17(2)3)20(22(25)19-13-9-6-10-14-19)15-24-28-16-18-11-7-5-8-12-18/h5-15,17,22,25H,4,16H2,1-3H3/b21-20+,24-15+ |
| InChIKey | XPSSDBBEOXWRMH-DZQOVBMMSA-N |
| XLogP | 4.44 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|