C16H25NO6P+ — CID 134524632
ethoxy-oxo-[(4R,5R,6S,7E)-4,5,6-trihydroxy-7-phenylmethoxyiminoheptan-2-yl]phosphanium (PubChem CID 134524632) has the molecular formula C16H25NO6P+ and a molecular weight of 358.35 g/mol. Its IUPAC name is ethoxy-oxo-[(4R,5R,6S,7E)-4,5,6-trihydroxy-7-phenylmethoxyiminoheptan-2-yl]phosphanium.
| Compound Name | ethoxy-oxo-[(4R,5R,6S,7E)-4,5,6-trihydroxy-7-phenylmethoxyiminoheptan-2-yl]phosphanium |
|---|---|
| PubChem CID | 134524632 |
| Molecular Formula | C16H25NO6P+ |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethoxy-oxo-[(4R,5R,6S,7E)-4,5,6-trihydroxy-7-phenylmethoxyiminoheptan-2-yl]phosphanium |
| SMILES | CCO[P+](=O)C(C)C[C@@H](O)[C@@H](O)[C@@H](O)/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C16H25NO6P/c1-3-23-24(21)12(2)9-14(18)16(20)15(19)10-17-22-11-13-7-5-4-6-8-13/h4-8,10,12,14-16,18-20H,3,9,11H2,1-2H3/q+1/b17-10+/t12?,14-,15+,16-/m1/s1 |
| InChIKey | XUHIHZSNFZILNQ-WUVJNCCXSA-N |
| XLogP | 1.83 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|