C15H23NO5 — CID 118336506
(2R,3S,4S,5Z)-1,3,4-trimethoxy-5-phenylmethoxyiminopentan-2-ol (PubChem CID 118336506) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2R,3S,4S,5Z)-1,3,4-trimethoxy-5-phenylmethoxyiminopentan-2-ol.
| Compound Name | (2R,3S,4S,5Z)-1,3,4-trimethoxy-5-phenylmethoxyiminopentan-2-ol |
|---|---|
| PubChem CID | 118336506 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2R,3S,4S,5Z)-1,3,4-trimethoxy-5-phenylmethoxyiminopentan-2-ol |
| SMILES | COC[C@@H](O)[C@H](OC)[C@H](/C=N\OCc1ccccc1)OC |
| InChI | InChI=1S/C15H23NO5/c1-18-11-13(17)15(20-3)14(19-2)9-16-21-10-12-7-5-4-6-8-12/h4-9,13-15,17H,10-11H2,1-3H3/b16-9-/t13-,14+,15+/m1/s1 |
| InChIKey | WDLJQIJYXNTLCA-GWGGVYHWSA-N |
| XLogP | 1.23 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|