C20H39NO4Si3 — CID 14767957
(E)-N-phenylmethoxy-2,3,4-tris(trimethylsilyloxy)butan-1-imine (PubChem CID 14767957) has the molecular formula C20H39NO4Si3 and a molecular weight of 441.79 g/mol. Its IUPAC name is (E)-N-phenylmethoxy-2,3,4-tris(trimethylsilyloxy)butan-1-imine.
| Compound Name | (E)-N-phenylmethoxy-2,3,4-tris(trimethylsilyloxy)butan-1-imine |
|---|---|
| PubChem CID | 14767957 |
| Molecular Formula | C20H39NO4Si3 |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (E)-N-phenylmethoxy-2,3,4-tris(trimethylsilyloxy)butan-1-imine |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(/C=N/OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C20H39NO4Si3/c1-26(2,3)23-17-20(25-28(7,8)9)19(24-27(4,5)6)15-21-22-16-18-13-11-10-12-14-18/h10-15,19-20H,16-17H2,1-9H3/b21-15+ |
| InChIKey | NESSSEJYAHXPJT-RCCKNPSSSA-N |
| XLogP | 5.48 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|